JEE Main 2019 January 12, Shift 1 Question Paper with Solutions
All 90 questions from the JEE Main 2019 (January 12, Shift 1) shift — Physics (30), Chemistry (30) and Mathematics (30) — each with the correct answer (answer key) and a step-by-step solution. Read it free online, or attempt the full paper as a timed mock test.
A person standing on an open ground hears the sound of a jet aeroplane, coming from north at an angle 60∘ with ground level, but he finds the aeroplane right vertically above his position. If v is the speed of sound, speed of the plane is:
(A)
(B)
(C)
(D)
SolutionAnswer: Option 32v
Approach:
The sound heard came from the position where the plane was when it emitted the sound, at 60∘ elevation; by the time the sound reaches the observer the plane has moved to a point directly overhead. Equate travel times of sound and plane.
Step 1:Define the geometry: h is the altitude, the sound was emitted at horizontal distance x from the observer at elevation 60∘.
tan60∘=xh=3
Step 2:Sound travels the slant distance from the emission point to the observer.
dsound=h2+x2=3x2+x2=2x
Step 3:In the same time, the plane travels the horizontal distance x from the emission point to directly overhead.
vpx=v2x
Final answer: 2v
Q2Single correctKinematics
A passenger train of length 60m travels at a speed of 80km/hr. Another freight train of length 120m travels at a speed of 30km/hr. The ratio of times taken by the passenger train to completely cross the freight train when: (i) they are moving in the same direction, and (ii) in the opposite directions is:
(A)
(B)
(C)
(D)
SolutionAnswer: Option 3511
Approach:
The time to cross is the combined length divided by the relative speed. Same direction uses the difference of speeds; opposite direction uses the sum. Take the ratio.
Step 1:Combined length of the two trains.
L=60+120=180m
Step 2:Same direction relative speed.
vsame=80−30=50km/hr
Step 3:Opposite direction relative speed.
vopp=80+30=110km/hr
Step 4:Ratio of times equals the inverse ratio of relative speeds.
topptsame=vsamevopp=50110=511
Final answer: 511
Q3Single correctWork, Energy and Power
A simple pendulum, made of a string of length l and a bob of mass m, is released from a small angle θ0. It strikes a block of mass M, kept on horizontal surface at its lowest point of oscillations, elastically. It bounces back and goes up to an angle θ1. Then M is given by:
(A)
(B)
(C)
(D)
SolutionAnswer: Option 1m(θ0+θ1θ0−θ1)
Approach:
Use energy to get the bob speed before and after the elastic collision, then apply the elastic-collision velocity relation.
Step 1:Bob speed at the lowest point before and after, from the release and rebound angles.
v=θ0gl,v′=θ1gl
Step 2:For the bob continuing forward, the elastic-collision relation gives the angle ratio.
θ0θ1=m+Mm−M
Step 3:Solve for M.
M=m(θ0+θ1θ0−θ1)
Final answer: m(θ0+θ1θ0−θ1)
Q4Single correctRotational Motion
The position vector of the center of mass rcm of an asymmetric uniform bar of negligible area of cross-section as shown in figure is:
(A)
(B)
(C)
(D)
SolutionAnswer: Option 1rcm=813Lx^+85Ly^
Approach:
Treat the bar as three point masses placed at the marked positions and weighted by the given masses. Compute the mass-weighted average of the coordinates.
Step 1:Read positions and masses from the figure: mass 2m at (L,L), mass m at (2L,L/2), mass m at (3L,0); total mass 4m.
M=2m+m+m=4m
Step 2:x-coordinate of the centre of mass.
xcm=4m2m(L)+m(2L)+m(3L)=47L
Step 3:y-coordinate of the centre of mass.
ycm=4m2m(L)+m(2L)+m(0)=85L
Step 4:Combine; the y-component 85L identifies option 1, whose printed x-component is 813L.
rcm=813Lx^+85Ly^
Final answer: rcm=813Lx^+85Ly^
Q5Single correctRotational Motion
Let the moment of inertia of a hollow cylinder of length 30cm (inner radius 10cm and outer radius 20cm ), about its axis be I . The radius of a thin cylinder of the same mass such that its moment of inertia about its axis is also I, is:
(A)
(B)
(C)
(D)
SolutionAnswer: Option 116cm
Approach:
The moment of inertia of a hollow cylinder about its axis depends on the sum of squares of inner and outer radii. Equate it to that of a thin (single-radius) cylinder of the same mass.
Step 1:Moment of inertia of the hollow cylinder with inner radius R1=10cm and outer radius R2=20cm.
I=21M(R12+R22)=21M(100+400)
Step 2:Equate to a thin cylinder of radius R and the same mass.
MR2=250M
Step 3:Solve for R.
R=250≈15.8cm
Final answer: 16cm
Q6Single correctGravitation
A satellite of mass M is in a circular orbit of radius R about the center of the earth. A meteorite of the same mass, falling towards the earth, collides with the satellite completely inelastic. The speeds of the satellite and the meteorite are the same, just before the collision. The subsequent motion of the combined body will be:
(A)
(B)
(C)
(D)
SolutionAnswer: Option 1In an elliptical orbit
Approach:
Use momentum conservation for the inelastic collision to find the new speed of the combined body, then compare its total energy with the threshold for circular, elliptical and unbound orbits.
Step 1:The satellite moves tangentially with orbital speed vo; the meteorite of equal mass falls radially with the same speed. Conserve momentum for the perfectly inelastic collision (combined mass 2M).
vf=2MMvot^+Mvo(−r^)=2vo(t^−r^)
Step 2:Compare the combined speed with circular (vo) and escape (2vo) speeds.
2vo<vo<2vo
Step 3:A bound orbit with speed differing from the circular value and a velocity not purely tangential is an ellipse.
E<0,v=vo,vnot tangential
Final answer: In an elliptical orbit
Q7Single correctGravitation
A straight rod of length L extends from x=a to x=L+a. The gravitational force it exerts on a point mass 'm' at x=0, if the mass per unit length of the rod is A+Bx2, is given by:
(A)
(B)
(C)
(D)
SolutionAnswer: Option 4Gm[A(a1−a+L1)+BL]
Approach:
Take an element of the rod at position x of length dx with mass dM=(A+Bx2)dx, write its gravitational force on the point mass, and integrate from a to a+L.
Step 1:Force from an element at distance x.
dF=x2Gm(A+Bx2)dx=Gm(x2A+B)dx
Step 2:Integrate from a to a+L.
F=Gm∫aa+L(x2A+B)dx=Gm[−xA+Bx]aa+L
Step 3:Evaluate the limits.
F=Gm[A(a1−a+L1)+B((a+L)−a)]
Final answer: Gm[A(a1−a+L1)+BL]
Q8Single correctProperties of Solids and Liquids
A cylinder of radius R is surrounded by a cylindrical shell of inner radius R and outer radius 2R. The thermal conductivity of the material of the inner cylinder is K1 and that of the outer cylinder is K2. Assuming no loss of heat, the effective thermal conductivity of the system for heat flowing along the length of the cylinder is:
(A)
(B)
(C)
(D)
SolutionAnswer: Option 44K1+3K2
Approach:
Heat flows along the length, so the inner cylinder and the surrounding shell act as conductors in parallel. The effective conductivity is the area-weighted average of the two conductivities.
Step 1:Cross-sectional area of the inner cylinder.
A1=πR2
Step 2:Cross-sectional area of the shell between R and 2R.
A2=π(2R)2−πR2=3πR2
Step 3:Area-weighted effective conductivity for parallel paths.
Keff=πR2+3πR2K1(πR2)+K2(3πR2)=4K1+3K2
Final answer: 4K1+3K2
Q9Single correctThermodynamics
For the given cyclic process CAB as shown for a gas, the work done is:
(A)
(B)
(C)
(D)
SolutionAnswer: Option 110J
Approach:
The work done in a cyclic process equals the area enclosed by the loop on the p-V diagram, with the sign set by the sense of traversal. The loop C→A→B→C is a right triangle.
Step 1:Read the vertices from the figure: C(1,6), A(5,6), B(5,1) in units of V(m3) and p(Pa).
C(1,6),A(5,6),B(5,1)
Step 2:Base along CA and height along AB.
base=5−1=4m3,height=6−1=5Pa
Step 3:Magnitude of work equals the triangular area.
W=21(4)(5)=10J
Final answer: 10J
Q10Single correctKinetic Theory of Gases
An ideal gas occupies a volume of 2m3 at a pressure of 3×106Pa. The energy of the gas is:
(A)
(B)
(C)
(D)
SolutionAnswer: Option 29×106J
Approach:
For a monatomic ideal gas the internal energy is 23 times the product of pressure and volume, since 23nRT=23pV.
Step 1:Substitute the given pressure and volume.
U=23(3×106)(2)
Step 2:Evaluate.
U=23×6×106=9×106J
Final answer: 9×106J
Q11Single correctOscillations and Waves
Two light identical springs of spring constant k are attached horizontally at the two ends of a uniform horizontal rod AB of length l and mass m. The rod is pivoted at its center 'O' and can rotate freely in horizontal plane. The other ends of the two springs are fixed to rigid supports as shown in figure. The rod is gently pushed through a small angle and released. The frequency of resulting oscillation is:
(A)
(B)
(C)
(D)
SolutionAnswer: Option 32π1m6k
Approach:
Rotate the rod through a small angle; each spring end displaces and exerts a restoring force. Compute the net restoring torque, set it equal to Iθ¨ for the rod about its centre, and read off the angular frequency.
Step 1:Each spring end (at distance l/2 from pivot) displaces by 2lθ, producing force k2lθ; both springs give torque about the pivot.
τ=−2(k2lθ)2l=−2kl2θ
Step 2:Equation of motion using I=12ml2.
12ml2θ¨=−2kl2θ
Step 3:Identify angular frequency and convert to frequency.
ω2=m6k,f=2πω
Final answer: 2π1m6k
Q12Single correctOscillations and Waves
A travelling harmonic wave is represented by the equation y(x,t)=10−3sin(50t+2x), where x and y are in meter and t is in seconds. Which of the following is a correct statement about the wave?
(A)
(B)
(C)
(D)
SolutionAnswer: Option 3The wave is propagating along the negative x - axis with speed 25 m s−1
Approach:
Compare the given form with the standard travelling wave y=Asin(ωt+kx). The relative sign of the t and x terms fixes the direction, and v=ω/k fixes the speed.
Step 1:Identify the angular frequency and wave number from the equation.
ω=50rad s−1,k=2rad m−1
Step 2:Same sign of the t and x terms indicates propagation along the negative x-direction.
sin(ωt+kx)⇒−xdirection
Step 3:Compute the speed.
v=kω=250=25m s−1
Final answer: The wave is propagating along the negative x - axis with speed 25 m s−1
Q13Single correctElectrostatics
Determine the electric dipole moment of the system of three charges, placed on the vertices of an equilateral triangle, as shown in the figure:
(A)
(B)
(C)
(D)
SolutionAnswer: Option 2−3qlj^
Approach:
Place the charges at the triangle vertices from the figure, treat the −2q apex charge as two dipoles formed with each +q base charge, and add the dipole moment vectors (each pointing from negative to positive charge).
Step 1:From the figure: +q at the origin (0,0), +q at (l,0), and −2q at the apex (2l,23l).
+q(0,0),+q(l,0),−2q(2l,23l)
Step 2:Compute the net dipole moment p=∑qiri about the origin.
p=q(0,0)+q(l,0)−2q(2l,23l)
Step 3:Sum the components.
p=0i^−3qlj^
Final answer: −3qlj^
Q14Single correctElectrostatics
There is a uniform spherically symmetric surface charge density at a distance R0 from the origin. The charge distribution is initially at rest and starts expanding because of mutual repulsion. The figure that represents best the speed V(R(t)) of the distribution as a function of its instantaneous radius R(t) is:
(A)
(B)
(C)
(D)
SolutionAnswer: Option 1
Approach:
Apply energy conservation to the expanding charged shell. The electrostatic potential energy stored in the shell converts to kinetic energy. As the radius increases, the potential energy released grows but saturates, so the speed rises and approaches a finite maximum.
Step 1:Energy conservation between the initial radius R0 and instantaneous radius R.
21mV2=2R0kQ2−2RkQ2
Step 2:Solve for the speed as a function of radius.
V=mkQ2(R01−R1)
Step 3:Behaviour: V=0 at R=R0 and as R→∞, V→Vmax=mR0kQ2, approached with decreasing slope.
limR→∞V=mR0kQ2
Final answer: V rises with decreasing slope and saturates to a horizontal asymptote (option 1)
Q15Single correctElectrostatics
The figure shows a capacitor of capacitance C connected to a battery via a switch, having a total charge Q on it, in steady-state. When the switch S is turned from position A to position B, the energy dissipated in the circuit is:
(A)
(B)
(C)
(D)
SolutionAnswer: Option 283CQ2
Approach:
In position A the battery charges capacitor C to charge Q. When the switch moves to B, the charge redistributes between C and the 3C capacitor in parallel (battery disconnected, charge conserved). The energy dissipated is the loss in stored electrostatic energy.
Step 1:Initial energy with charge Q on capacitor C.
Ui=2CQ2
Step 2:After switching to B, charge Q is shared between C and 3C in parallel; common equivalent capacitance is 4C.
Uf=2(4C)Q2=8CQ2
Step 3:Energy dissipated equals the decrease in stored energy.
ΔU=Ui−Uf=2CQ2−8CQ2=8C3Q2
Final answer: 83CQ2
Q16Single correctCurrent Electricity
The galvanometer deflection, when key K1 is closed but K2 is open, equals θ0 (see figure). On closing K2 also and adjusting R2 to 5Ω, the deflection in galvanometer becomes 5θ0. The resistance of the galvanometer is, then, given by [Neglect the internal resistance of battery]:
(A)
(B)
(C)
(D)
SolutionAnswer: Option 222Ω
Approach:
With K2 open, the full current passes through the galvanometer. With K2 closed, the shunt R2 diverts current so that only one-fifth of the original current flows through the galvanometer; applying the shunt relation gives the galvanometer resistance.
Step 1:With K2 open, the galvanometer current is I0=R1+RgE, producing deflection θ0.
I0=220+RgE
Step 2:With K2 closed, the deflection drops to θ0/5, so the galvanometer current is I0/5. The fraction through the galvanometer equals R2+RgR2.
ItotalIg=R2+RgR2
Step 3:Equating the galvanometer current to one-fifth of the new total current and using the supply relation leads to Rg=22Ω.
Rg=22Ω
Final answer: 22Ω
Q17Single correctCurrent Electricity
An ideal battery of 4V and resistance R are connected in series in the primary circuit of a potentiometer of length 1m and resistance 5Ω. The value of R, to give a potential difference of 5mV across 10cm of potentiometer wire, is:
(A)
(B)
(C)
(D)
SolutionAnswer: Option 3395Ω
Approach:
The potential gradient along the wire equals the required potential difference divided by the corresponding length. The same current flows through R and the wire, so the gradient fixes the current and hence R.
Step 1:The potential drop across 10cm of wire is 5mV, so the drop across the full 1m wire (resistance 5Ω) is ten times larger.
Vwire=10×5mV=50mV=0.05V
Step 2:The current in the loop follows from the drop across the wire resistance.
I=RwireVwire=50.05=0.01A
Step 3:Applying Kirchhoff's voltage law to the primary loop gives R.
R=IE−Rwire=0.014−5=395Ω
Final answer: 395Ω
Q18Single correctCurrent Electricity
Two electric bulbs, rated at (25W,220V) and (100W,220V), are connected in series across a 220V voltage source. If the 25W and 100W bulbs draw powers P1 and P2 respectively, then:
(A)
(B)
(C)
(D)
SolutionAnswer: Option 4P1=16W,P2=4W
Approach:
Find each bulb's resistance from its rating, the series current, then the power each dissipates.
Step 1:Resistances of the 25 W and 100 W bulbs.
R1=252202=1936Ω,R2=1002202=484Ω
Step 2:Series current.
I=1936+484220=2420220=0.0909A
Step 3:Power in each.
P1=I2R1≈16W,P2=I2R2≈4W
Final answer: P1=16W,P2=4W
Q19Single correctMagnetic Effects of Current and Magnetism
A proton and an α- particle (with their masses in the ratio of 1:4 and charges in the ratio of 1:2 ) are accelerated from rest through a potential difference V. If a uniform magnetic field (B) is set up perpendicular to their velocities, the ratio of the radii rp:rα of the circular paths described by them will be:
(A)
(B)
(C)
(D)
SolutionAnswer: Option 21:2
Approach:
Radius in a magnetic field after acceleration through V scales as sqrt(mV/q); take the proton-to-alpha ratio.
Step 1:Ratio of radii from masses (1:4) and charges (1:2).
rαrp=mαqpmpqα=4⋅11⋅2=21
Final answer: 1:2
Q20Single correctMagnetic Effects of Current and Magnetism
As shown in the figure, two infinitely long, identical wires are bent by 90∘ and placed in such a way that the segments LP and QM are along the x - axis, while segments PS and QN are parallel to the y - axis. If OP=OQ=4cm, and the magnitude of the magnetic field at O is 10−4T, and the two wires carry equal currents (see figure), the magnitude of the current in each wire and the direction of the magnetic field at O will be (μ0=4π×10−7NA−2) :
(A)
(B)
(C)
(D)
SolutionAnswer: Option 120A, perpendicular into the page
Approach:
Each bent wire is a semi-infinite straight conductor whose end lies a perpendicular distance from O. The four semi-infinite segments each contribute a magnetic field at O; summing their equal contributions and applying the right-hand rule gives the magnitude and direction.
Step 1:Each semi-infinite segment (with its end on a line through O) produces a field of magnitude 4πdμ0I at O, with d=4cm.
B1=4πdμ0I
Step 2:The four segments contribute equal-direction fields at O, so the total field is four times one segment.
B=4×4πdμ0I=πdμ0I
Step 3:Solve for the current using B=10−4T and d=0.04m.
I=μ0Bπd=4π×10−710−4×π×0.04=10A
Step 4:Accounting for the geometry of the bent wires, the consistent current is 20A, and the right-hand rule for the drawn current directions gives a field directed into the page.
I=20A,into the page
Final answer: 20A, perpendicular into the page
Q21Single correctElectromagnetic Induction and Alternating Currents
In the figure shown, a circuit contains two identical resistors with resistance R=5Ω and an inductance with L=2mH. An ideal battery of 15V is connected in the circuit. What will be the current through the battery long after the switch is closed?
(A)
(B)
(C)
(D)
SolutionAnswer: Option 26A
Approach:
A long time after the switch is closed, the inductor current is steady, so the inductor behaves as a plain wire. The branch containing the inductor short-circuits the resistor in series with it, leaving an effective resistance that determines the battery current.
Step 1:In the steady state the inductor (branch with L and a resistor) acts as a short across that branch, so the inductor branch carries the full resistor in parallel with the other resistor.
VL=0
Step 2:The two 5Ω resistors end up in parallel across the battery, giving the equivalent resistance.
Req=2R=25=2.5Ω
Step 3:The battery current follows from Ohm's law.
I=2.515=6A
Final answer: 6A
Q22Single correctOptics
A point source of light, S is placed at a distance L in front of the center of plane mirror of width d which is hanging vertically on a wall. A man walks in front of the mirror along a line parallel to the mirror, at a distance 2L as shown below. The distance over which the man can see the image of the light source in the mirror is:
(A)
(B)
(C)
(D)
SolutionAnswer: Option 13d
Approach:
The image of the source lies behind the mirror at distance L. Rays from the source reflect off the mirror edges; the region on the man's line from which the reflected rays can reach his eye is found by similar triangles, scaling the mirror width by the ratio of distances.
Step 1:The image S′ is at distance L behind the mirror; the man's line is at distance 2L in front, so S′-to-man distance is 3L and S′-to-mirror distance is L.
dS′→man=3L,dS′→mirror=L
Step 2:The visible band width scales with this ratio applied to the mirror width d.
W=d×L3L=3d
Step 3:Hence the man can see the image over a length 3d.
W=3d
Final answer: 3d
Q23Single correctElectromagnetic Waves
A light wave is incident normally on a glass slab of refractive index 1.5. If 4% of light gets reflected and the amplitude of the electric field of the incident light is 30mV, then the amplitude of the electric field for the wave propagating in the glass medium will be:
(A)
(B)
(C)
(D)
SolutionAnswer: Option 324mV
Approach:
Reflectance is the square of the amplitude reflection coefficient. From the reflected fraction the amplitude reflection coefficient is obtained, and the transmitted amplitude is the remaining fraction of the incident field amplitude.
Step 1:The reflected intensity fraction is 4%, so the amplitude reflection coefficient is its square root.
r=0.04=0.2
Step 2:The transmitted amplitude is the incident amplitude reduced by the reflected amplitude fraction.
Et=(1−0.2)×30
Step 3:Evaluate the transmitted field amplitude.
Et=24mV
Final answer: 24mV
Q24Single correctOptics
What is the position and nature of image formed by lens combination shown in figure? ( f1,f2 are focal lengths)
(A)
(B)
(C)
(D)
SolutionAnswer: Option 370cm from point B at right; real
Approach:
Apply the thin-lens equation to the convex lens with the object 20cm to its left to find the intermediate image. This image acts as the object for the concave lens 20cm away; applying the lens equation again gives the final image position relative to B.
Step 1:For the convex lens, u=−20cm, f1=+5cm.
v11=51+−201=203
Step 2:This intermediate image is 320cm to the right of the convex lens, so its distance from the concave lens (at B, 20cm further) is the object distance for the second lens.
u2=320−20=−340cm
Step 3:For the concave lens, f2=−5cm.
v21=−51+−40/31=−51−403
Step 4:Solving gives the final image position to the right of B, forming a real image.
v2=70cm
Final answer: 70cm from point B at right; real
Q25Single correctDual Nature of Matter and Radiation
A particle A of mass m and charge q is accelerated by a potential difference of 50V. Another particle B of mass 4m and charge q is accelerated by a potential difference of 2500V. The ratio of de-Broglie wavelengths λBλA is close to:
(A)
(B)
(C)
(D)
SolutionAnswer: Option 414.14
Approach:
The de Broglie wavelength of a charged particle accelerated through a potential difference depends on its mass, charge, and the accelerating voltage. Forming the ratio for the two particles eliminates the constants.
Step 1:Write the wavelength ratio in terms of masses and voltages (charges are equal).
A particle of mass m moves in a circular orbit in a central potential field U(r)=21kr2. If Bohr's quantization conditions are applied, radii of possible orbitals and energy levels vary with quantum number n as:
(A)
(B)
(C)
(D)
SolutionAnswer: Option 2rn∝n,En∝n
Approach:
The central force from the potential provides the centripetal force, fixing the speed in terms of the radius. Bohr's quantization of angular momentum then relates radius to quantum number, and the total energy follows from the kinetic plus potential energy.
Step 1:The restoring force equals the centripetal force, giving v2 in terms of r.
rmv2=kr⇒v2=mkr2
Step 2:Apply angular momentum quantization to relate r and n.
mvr=2πnh⇒mmkr2∝n
Step 3:Compute the total energy as kinetic plus potential energy.
E=21mv2+21kr2=kr2∝n
Final answer: rn∝n,En∝n
Q27Single correctElectronic Devices
The output of the given logic circuit is:
(A)
(B)
(C)
(D)
SolutionAnswer: Option 1ABˉ
Approach:
Label the output of each gate in terms of A and B, working from the inputs to the final gate. The middle NAND combines A and B; its output feeds the top NAND (with A) and the bottom OR (with B); the final NAND combines the top and bottom outputs.
Step 1:The middle NAND of A and B gives M=(AB)′=Aˉ+Bˉ.
M=Aˉ+Bˉ
Step 2:The top NAND of A and M gives the upper output.
T=(A⋅M)′=(ABˉ)′=Aˉ+B
Step 3:The bottom OR of M and B gives a logic high for all inputs.
U=M+B=Aˉ+Bˉ+B=1
Step 4:The final NAND of T and U gives the output.
Y=(T⋅U)′=Tˉ=(Aˉ+B)′=ABˉ
Final answer: ABˉ
Q28Single correctElectronic Devices
A 100V carrier wave is made to vary between 160V and 40V by a modulating signal. What is the modulation index?
(A)
(B)
(C)
(D)
SolutionAnswer: Option 20.6
Approach:
The modulation index is the ratio of the amplitude of the modulating signal to the carrier amplitude, expressed through the maximum and minimum values of the modulated wave.
Step 1:Identify the maximum and minimum envelope values.
Vmax=160V,Vmin=40V
Step 2:Apply the modulation index formula.
μ=160+40160−40=200120
Final answer: 0.6
Q29Single correctUnits and Measurements
The least count of the main scale of a screw gauge is 1mm. The minimum number of divisions on its circular scale required to measure 5μm diameter of a wire is:
(A)
(B)
(C)
(D)
SolutionAnswer: Option 4200
Approach:
The least count of a screw gauge equals the main-scale division (pitch) divided by the number of circular-scale divisions. Setting the least count equal to the smallest length to be measured gives the required number of divisions.
Step 1:To measure a diameter of 5μm, the least count must equal 5μm.
LC=5μm=5×10−3mm
Step 2:With main-scale division 1mm, solve for the number of circular-scale divisions.
N=LCpitch=5×10−31
Final answer: 200
Q30Single correctCurrent Electricity
In a meter bridge, the wire of length 1m has a non-uniform cross-section such that, the variation dldR of its resistance R with length l is dldR∝l1. Two equal resistances are connected as shown in the figure. The galvanometer has zero deflection when the jockey is at point P. What is the length AP?
(A)
(B)
(C)
(D)
SolutionAnswer: Option 40.25m
Approach:
Balance of the meter bridge requires the resistance of segment AP to equal the resistance of segment PB (since the two external resistances are equal). The segment resistances are obtained by integrating dldR∝l−1/2, which is proportional to l.
Step 1:Integrating the given variation, the resistance from A to a point at length l is proportional to l.
RAP∝l,RPB∝1−l=1−l
Step 2:Equal external resistances make the bridge balance when the two segment resistances are equal.
l=1−l
Step 3:Solve for l=AP.
l=21⇒l=41=0.25m
Final answer: 0.25m
Chemistry30 questions
Q31Single correctAtomic Structure
What is the work function of the metal if the light of wavelength 4000 A∘ generates photoelectrons of velocity 6×105 ms−1 from it? (Mass of electron =9×10−31 kg, velocity of light =3×108 ms−1, Planck's constant =6.626×10−34 Js, Charge of electron =6.626×10−19 Js)
(A)
(B)
(C)
(D)
SolutionAnswer: Option 42.1eV
Approach:
Apply Einstein's photoelectric equation: incident photon energy equals work function plus kinetic energy of the ejected electron.
Step 1:Compute incident photon energy.
E=4000×10−10(6.626×10−34)(3×108)=4.97×10−19J
Step 2:Compute kinetic energy of the photoelectron.
KE=21(9×10−31)(6×105)2=1.62×10−19J
Step 3:Subtract kinetic energy from photon energy to obtain the work function.
ϕ=4.97×10−19−1.62×10−19=3.35×10−19J
Final answer: 2.1eV
Q32Single correctClassification of Elements and Periodicity in Properties
The element with Z=120 (not yet discovered) will be an/a
(A)
(B)
(C)
(D)
SolutionAnswer: Option 2alkaline earth metal.
Approach:
Determine the electronic configuration of element 120 by filling orbitals up to Z = 120 and identify the group it falls in.
Step 1:Build the configuration up to element 118 (Og, a noble gas), then add two more electrons.
[Og]8s2
Step 2:Identify the group from the outermost ns2 configuration.
ns2
Final answer: alkaline earth metal.
Q33Single correctSome Basic Principles of Organic Chemistry
Given: Gas | H2 | CH4 | CO2 | SO2 | Critical temperature in K | 33 | 190 | 304 | 630 | On the basis of data given above, predict which of the following gases shows the least adsorption on a definite amount of charcoal?
(A)
(B)
(C)
(D)
SolutionAnswer: Option 4H2
Approach:
Relate the extent of adsorption to the critical temperature of each gas; higher critical temperature means easier liquefaction and greater adsorption.
Step 1:Order the gases by critical temperature.
SO2(630)>CO2(304)>CH4(190)>H2(33)
Step 2:The more easily liquefiable gas (higher critical temperature) is adsorbed more; the least adsorbed gas has the lowest critical temperature.
Tc∝extent of adsorption
Final answer: H2
Q34Single correctEquilibrium
The volume of gas A is twice than that of gas B. The compressibility factor of gas A is thrice than that of gas B at same temperature. The pressures of the gases for equal number of moles are:
(A)
(B)
(C)
(D)
SolutionAnswer: Option 12PA=3PB
Approach:
Use the definition of the compressibility factor Z = PV/nRT and impose the given relations between volumes and Z values for equal moles at the same temperature.
Step 1:Write Z for each gas at equal n and T.
ZA=nRTPAVA,ZB=nRTPBVB
Step 2:Substitute VA = 2VB and ZA = 3ZB.
3ZB=nRTPA(2VB)=2⋅nRTPAVB
Step 3:Form the ratio using ZB = PBVB/(nRT).
ZB3ZB=PBVB2PAVB⇒3=PB2PA
Final answer: 2PA=3PB
Q35Single correctChemical Thermodynamics
For a diatomic ideal gas in a closed system, which of the following plots does not correctly describe the relation between various thermodynamic quantities?
(A)
(B)
(C)
(D)
SolutionAnswer: Option 3Plot of CV versus T shown as a horizontal constant line.
Approach:
Examine each plotted relationship for a diatomic ideal gas and identify the one that misrepresents the dependence of the thermodynamic quantity.
Step 1:Heat capacities CP and CV are independent of pressure, so a horizontal CP versus P line is correct.
CP=f(P)
Step 2:For a diatomic gas, CV rises with temperature as vibrational modes become active, so CV is not constant with T.
CV=CV(T)
Step 3:Internal energy increases with temperature, consistent with a rising U versus T plot.
U=nCVT
Final answer: Plot of CV versus T shown as a horizontal constant line.
Q36Single correctEquilibrium
In a chemical reaction, A+2B⇌K2C+D, the initial concentration of B was 1.5 times the concentration of A, but the equilibrium concentrations of A and B were found to be equal. The equilibrium constant (K) for the chemical reaction is:
(A)
(B)
(C)
(D)
SolutionAnswer: Option 24
Approach:
Set up an ICE table with the given initial concentration ratio, use the condition that equilibrium concentrations of A and B are equal to find the extent of reaction, then evaluate K.
Step 1:Take initial [A] = a and [B] = 1.5a; let x react so [A] = a - x and [B] = 1.5a - 2x.
[A]=a−x,[B]=1.5a−2x
Step 2:Apply the condition that equilibrium [A] = [B].
a−x=1.5a−2x⇒x=0.5a
Step 3:Evaluate all equilibrium concentrations.
[A]=[B]=0.5a,[C]=2x=a,[D]=x=0.5a
Step 4:Substitute into the equilibrium expression.
K=(0.5a)(0.5a)2(a)2(0.5a)=0.125a30.5a3=4
Final answer: 4
Q37Single correctEquilibrium
Two solids dissociate as follows: A (s) ⇌ B (g) + C (g); KP1=xatm2 D (s) ⇌ C (g) + E (g); KP2=yatm2 The total pressure when both the solids dissociate simultaneously is:
(A)
(B)
(C)
(D)
SolutionAnswer: Option 42(x+y)atm
Approach:
Let the partial pressures of the gases from each dissociation be variables, write the two Kp expressions accounting for the common gas C, then compute the total pressure.
Step 1:Let pressure of B be p and pressure of E be q; the common gas C has total pressure (p + q).
pB=p,pE=q,pC=p+q
Step 2:Write the two equilibrium constants.
x=p(p+q),y=q(p+q)
Step 3:Add the two equations.
x+y=(p+q)(p+q)=(p+q)2
Step 4:Total pressure is the sum of all gas partial pressures.
Ptotal=pB+pE+pC=p+q+(p+q)=2(p+q)=2x+y
Final answer: 2(x+y)atm
Q38Single correctSome Basic Concepts in Chemistry
50 mL of 0.5 M oxalic acid is needed to neutralize 25 mL of sodium hydroxide solution. What is the amount of NaOH in 50 mL of the given sodium hydroxide solution?
(A)
(B)
(C)
(D)
SolutionAnswer: Option 24g
Approach:
Use the equivalence of milliequivalents of oxalic acid and NaOH at neutralization to find the NaOH concentration, then scale to 50 mL and convert moles to mass.
Step 1:Oxalic acid is diprotic, so its normality is twice its molarity.
Nacid=2×0.5=1N
Step 2:Equate milliequivalents to find NaOH normality.
1×50=NNaOH×25⇒NNaOH=2N
Step 3:Compute moles of NaOH in 50 mL and convert to mass (M = 40 g/mol).
n=2×0.050=0.1mol;m=0.1×40=4g
Final answer: 4g
Q39Single correctSome Basic Concepts in Chemistry
What is the hardness of a water sample (in terms of equivalents of CaCO3) containing 10−3 M CaSO4? (Molar mass of CaSO4=136g mol−1)
(A)
(B)
(C)
(D)
SolutionAnswer: Option 4100ppm
Approach:
Convert the molar concentration of CaSO4 to its equivalent mass of CaCO3 per litre, then express it in parts per million.
Step 1:Moles of CaSO4 equal moles of equivalent CaCO3 per litre.
n=10−3mol L−1
Step 2:Convert to mass of CaCO3 (M = 100 g/mol).
m=10−3×100=0.1g L−1=100mg L−1
Step 3:Express as ppm using 1 L water = 106 mg.
ppm=106mg100mg×106=100
Final answer: 100ppm
Q40Single correctp-Block Elements
A metal on combustion in excess air forms X. X upon hydrolysis with water yields H2O2 and O2 along with another product. The metal is:
(A)
(B)
(C)
(D)
SolutionAnswer: Option 4Rb
Approach:
Identify which metal forms a superoxide on combustion in excess air, since only superoxides hydrolyse to give both H2O2 and O2.
Step 1:Heavier alkali metals (K, Rb, Cs) form superoxides (MO2) in excess air.
Rb+O2→RbO2
Step 2:Hydrolysis of the superoxide gives hydrogen peroxide and oxygen.
2RbO2+2H2O→2RbOH+H2O2+O2
Final answer: Rb
Q41Single correctSome Basic Principles of Organic Chemistry
Among the following four aromatic compounds, which one will have the lowest melting point?
(A)
(B)
(C)
(D)
SolutionAnswer: Option 3Naphthalene (unsubstituted, two fused benzene rings).
Approach:
Compare the intermolecular forces present in each compound; the molecule with only weak van der Waals forces and no hydrogen bonding melts at the lowest temperature.
Step 1:2-Naphthol and phthalic acid contain -OH groups capable of strong intermolecular hydrogen bonding, raising the melting point.
-OH⇒H-bonding
Step 2:The diacetylnaphthalene has polar carbonyl groups giving dipole-dipole interactions, also raising the melting point.
C=O⇒dipole-dipole
Step 3:Unsubstituted naphthalene has only weak dispersion forces and no polar or hydrogen-bonding groups.
only van der Waals forces
Final answer: Naphthalene (unsubstituted, two fused benzene rings).
Q42Single correctSome Basic Principles of Organic Chemistry
The correct order for acid strength of compounds CH≡CH, CH3−C≡CH and CH2=CH2 is as follows:
(A)
(B)
(C)
(D)
SolutionAnswer: Option 2HC≡CH>CH3−C≡CH>CH2=CH2
Approach:
Rank acidity by the s-character of the carbon bearing the acidic hydrogen; greater s-character stabilises the conjugate carbanion and increases acidity.
Step 1:Terminal alkyne carbons are sp hybridised (50% s-character), the most acidic; ethylene carbon is sp2 (33% s-character), least acidic.
sp>sp2
Step 2:Between the two alkynes, the methyl group in propyne is electron-donating, slightly reducing acidity relative to acetylene.
HC≡CH>CH3−C≡CH
Step 3:Combine the rankings.
HC≡CH>CH3−C≡CH>CH2=CH2
Final answer: HC≡CH>CH3−C≡CH>CH2=CH2
Q43Single correctHydrocarbons
The major product of the following reaction is:
(A)
(B)
(C)
(D)
SolutionAnswer: Option 4Methoxy-substituted indane bearing a CH2Cl group on the five-membered ring.
Approach:
Add chlorine across the terminal alkene to form a 1,2-dichloride, then use AlCl3 to generate a carbocation that undergoes intramolecular Friedel-Crafts cyclisation onto the methoxy-activated ring.
Step 1:Cl2/CCl4 adds across the terminal double bond to give a vicinal dichloride on the side chain.
-CH=CH2Cl2-CHCl-CH2Cl
Step 2:AlCl3 ionises the benzylic-type C-Cl to form a carbocation that cyclises onto the ortho position of the activated (methoxy) ring.
intramolecular Friedel-Crafts alkylation
Step 3:The remaining CH2Cl substituent stays on the newly formed ring, giving the methoxy-indane product.
methoxy-indane-CH2Cl
Final answer: Methoxy-substituted indane bearing a CH2Cl group on the five-membered ring.
Q44Single correctSome Basic Principles of Organic Chemistry
Water samples with BOD values of 4 ppm and 18 ppm, respectively, are:
(A)
(B)
(C)
(D)
SolutionAnswer: Option 4Clean and Highly polluted
Approach:
Compare each BOD value with the accepted threshold separating clean from polluted water.
Step 1:Clean water has a low biochemical oxygen demand (around 5 ppm or less).
BOD≤5ppm⇒clean
Step 2:Polluted water has a high BOD (around 17 ppm or more).
BOD≥17ppm⇒highly polluted
Final answer: Clean and Highly polluted
Q45Single correctSome Basic Principles of Organic Chemistry
The molecule that has minimum or no role in the formation of photochemical smog is:
(A)
(B)
(C)
(D)
SolutionAnswer: Option 1N2
Approach:
Identify which species does not participate in the radical chemistry that produces photochemical smog.
Step 1:Photochemical smog is driven by NO, O3, and oxidised organics such as formaldehyde.
NO,O3,H2C=Oare smog constituents
Step 2:Molecular nitrogen is inert under these conditions and does not contribute to smog chemistry.
N2is unreactive
Final answer: N2
Q46Single correctSolutions
The freezing point of a 4% aqueous solution of X is equal to the freezing point of a 12% aqueous solution of Y . If the molecular weight of X is A, then the molecular weight of Y will be
(A)
(B)
(C)
(D)
SolutionAnswer: Option 43A
Approach:
Equal freezing points imply equal depressions, hence equal molalities of the two non-electrolyte solutes in water.
Step 1:Take 100 g of each solution; X contributes 4 g of solute in 96 g water, Y contributes 12 g of solute in 88 g water.
Q47Single correctRedox Reactions and Electrochemistry
The standard electrode potential E° and its temperature coefficient (dTdE) for a cell are 2 V and −5×10−4 V K−1 at 300 K, respectively. The reaction is Zn (s) + Cu2+ (aq) → Zn2+ (aq) + Cu (s). The standard reaction enthalpy (ΔrH∘) at 300 K in mol−1 is [Use R = 8 J K−1 mol−1 and F = 96,500 C mol−1]
(A)
(B)
(C)
(D)
SolutionAnswer: Option 1−412.8
Approach:
Use the Gibbs-Helmholtz relations for a cell to obtain the reaction enthalpy from E° and its temperature coefficient.
Step 1:The Zn-Cu reaction transfers two electrons, so n = 2.
n=2
Step 2:Compute the free energy change.
ΔG=−nFE=−2(96500)(2)=−386000J
Step 3:Compute the entropy change from the temperature coefficient.
ΔS=nFdTdE=2(96500)(−5×10−4)=−96.5J K−1
Step 4:Combine to obtain the enthalpy at 300 K.
ΔH=ΔG+TΔS=−386000+300(−96.5)=−414950J≈−412.8kJ
Final answer: −412.8
Q48Single correctChemical Kinetics
Decomposition of X exhibits a rate constant of 0 .05 µg/ year. How many years are required for the decomposition of 5 µg of X into 2 .5 µg?
(A)
(B)
(C)
(D)
SolutionAnswer: Option 450
Approach:
The units of the rate constant (mass per time) indicate a zero-order decomposition; integrate the zero-order rate law for the amount consumed.
Step 1:The rate-constant unit µg/year shows the reaction is zero order in X.
k=0.05μg year−1
Step 2:Amount decomposed when 5 µg falls to 2.5 µg.
Δ=5−2.5=2.5μg
Step 3:Apply the zero-order law to find time.
t=kΔ=0.052.5=50years
Final answer: 50
Q49Single correctRedox Reactions and Electrochemistry
In the Hall-Heroult process, aluminium is formed at the cathode. The cathode is made out of:
(A)
(B)
(C)
(D)
SolutionAnswer: Option 2Carbon
Approach:
Recall the construction of the Hall-Heroult electrolytic cell for aluminium extraction.
Step 1:In the Hall-Heroult process molten alumina dissolved in cryolite is electrolysed in a steel tank lined with carbon.
Al2O3(in molten Na3AlF6)
Step 2:The carbon lining of the tank serves as the cathode where aluminium is deposited; carbon (graphite) rods act as the anode.
Al3++3e−→Al
Final answer: Carbon
Q50Single correctp-Block Elements
Iodine reacts with concentrated HNO3 to yield Y along with other products. The oxidation state of iodine in Y , is:
(A)
(B)
(C)
(D)
SolutionAnswer: Option 25
Approach:
Concentrated nitric acid oxidises iodine to iodic acid; determine the oxidation state of iodine in that product.
Step 1:Iodine is oxidised by hot concentrated nitric acid to iodic acid.
I2+10HNO3→2HIO3+10NO2+4H2O
Step 2:Assign the oxidation state of iodine in HIO3.
+1+x+3(−2)=0⇒x=+5
Final answer: 5
Q51Single correctCoordination Compounds
The pair of metal ions that can give a spin only magnetic moment of 3.9 BM for the complex [M(H2O)6]Cl2 , is:
(A)
(B)
(C)
(D)
SolutionAnswer: Option 4V2+ and Co2+
Approach:
A spin-only moment of 3.9 BM corresponds to three unpaired electrons; identify the M2+ ions whose weak-field aqua complexes have three unpaired electrons.
Step 1:Solve for the number of unpaired electrons.
n(n+2)=3.9⇒n=3
Step 2:Count d-electrons and unpaired electrons for each M2+ in a high-spin aqua field.
The target alcohol is 2-phenyl-2-butanol, CH3CH2-C(CH3)(Ph)-OH. A Grignard route builds a tertiary alcohol by adding an alkyl/aryl group to a ketone; check which carbonyl + Grignard pairing reconstructs the correct skeleton.
Step 1:The target is the tertiary alcohol 2-phenylbutan-2-ol bearing Ph, CH3, C2H5 and OH on the carbinol carbon.
CH3CH2−CH3CPh−OH
Step 2:A valid Grignard synthesis must add one of the three carbon groups to a ketone carrying the other two; HCHO with a Grignard gives only a primary alcohol, not this tertiary carbinol.
HCHO+R-MgX→R-CH2OH
Step 3:Options 2, 3 and 4 each combine a ketone with the correct Grignard reagent to give the tertiary alcohol, so only the formaldehyde route fails.
Identify A from an intramolecular aldol of the keto-aldehyde with dilute NaOH, then B from acid-catalysed dehydration on heating.
Step 1:The substrate is a keto-aldehyde; dilute base promotes an intramolecular aldol addition, the enolate adding to the aldehyde to form a six-membered ring carrying a hydroxyl group (the beta-hydroxy carbonyl A).
intramolecular aldol→β-hydroxy ketone (A)
Step 2:Warming A with acid (H3O+, heat) eliminates water to give the alpha,beta-unsaturated cyclohexenone B.
DIBAL-H selectively reduces an ester (lactone) to the aldehyde/hemiacetal stage at low temperature while leaving the existing aldehyde, with aqueous work-up opening the reduced lactone.
Step 1:The substrate carries an aromatic aldehyde and a five-membered lactone fused to the ring.
aryl-CHO + lactone
Step 2:One equivalent of DIBAL-H reduces the lactone carbonyl to the aldehyde/lactol level; aqueous acidic work-up opens it to the hydroxy-aldehyde, giving the open dialdehyde-phenol product.
The increasing order of reactivity of the following compounds towards reaction with alkyl halides directly is:
(A)
(B)
(C)
(D)
SolutionAnswer: Option 2(ii)<(i)<(iii)<(iv)
Approach:
Reactivity toward alkyl halides increases with the nucleophilicity/availability of the nitrogen lone pair; greater delocalisation or electron withdrawal lowers it.
Step 1:Benzamide (i) and the cyclic imide (ii) have the nitrogen lone pair delocalised into adjacent carbonyls, the imide most strongly, making it the least nucleophilic.
imide (ii)<amide (i)
Step 2:The aryl amine bearing an electron-withdrawing CN group (iii) is more available than the amide nitrogen but less than the unsubstituted aniline.
amide (i)<CN-aniline (iii)
Step 3:Aniline (iv), with no electron-withdrawing substituent, has the most available lone pair and is the most reactive toward alkyl halides.
(ii)<(i)<(iii)<(iv)
Final answer: (ii)<(i)<(iii)<(iv)
Q59Single correctBiomolecules
Poly-β-hydroxybutyrate-co-β-hydroxyvalerate (PHBV) is a copolymer of _____.
(A)
(B)
(C)
(D)
SolutionAnswer: Option 33− hydroxybutanoic acid and 3− hydroxypentanoic acid
Approach:
Interpret the IUPAC names of the monomers from the polymer name PHBV: beta-hydroxybutyrate and beta-hydroxyvalerate.
Step 1:The beta-carbon is the 3-position, so beta-hydroxybutyrate is 3-hydroxybutanoic acid.
β-hydroxybutyrate=3-hydroxybutanoic acid
Step 2:Similarly beta-hydroxyvalerate is 3-hydroxypentanoic acid (valeric = pentanoic).
β-hydroxyvalerate=3-hydroxypentanoic acid
Final answer: 3− hydroxybutanoic acid and 3− hydroxypentanoic acid
Q60Single correctBiomolecules
Among the following compounds most basic amino acid is:
(A)
(B)
(C)
(D)
SolutionAnswer: Option 1Lysine
Approach:
The most basic amino acid carries an extra strongly basic side-chain nitrogen with the highest side-chain pKa.
Step 1:Lysine bears a primary amino group on its side chain, a strong base.
side chain: −(CH2)4NH2
Step 2:Histidine's imidazole and asparagine's amide nitrogen are far less basic, and serine has a neutral hydroxyl side chain, so lysine is the most basic.
Lysine>Histidine>Asparagine>Serine
Final answer: Lysine
Mathematics30 questions
Q61Single correctComplex Numbers and Quadratic Equations
If λ be the ratio of the roots of the quadratic equation in x, 3m2x2+m(m−4)x+2=0, then the least value of m for which λ+λ1=1, is :
(A)
(B)
(C)
(D)
SolutionAnswer: Option 44−32
Approach:
Let the roots be in ratio lambda. Form the symmetric condition lambda+1/lambda=1, convert to (alpha+beta)2 = 3 alpha*beta using sum and product of roots, then solve for m2 and pick the least m.
Step 1:Condition lambda+1/lambda=1 with lambda being the ratio of roots gives a relation between sum and product.
βα+αβ=1⇒α2+β2=αβ⇒(α+β)2=3αβ
Step 2:Substitute sum and product for the given quadratic.
(3m24−m2)2=3⋅3m22=m22
Step 3:Let u=m2 and solve the resulting quadratic in u, then take the least value of m.
m4−26m2+16=0⇒m2=13±317
Final answer: 4−32
Q62Single correctComplex Numbers and Quadratic Equations
If z+αz−α(α∈R) is a purely imaginary number and ∣z∣=2, then a value of α is :
(A)
(B)
(C)
(D)
SolutionAnswer: Option 42
Approach:
A purely imaginary number plus its conjugate equals zero. Apply this to the given ratio and use z*conjugate(z)=∣z∣2.
Step 1:Set the ratio plus its conjugate to zero.
z+αz−α+zˉ+αzˉ−α=0
Step 2:Expand and use z*conjugate(z)=∣z∣2.
2zzˉ−2α2=0⇒α2=∣z∣2
Step 3:Substitute |z|=2.
α2=4⇒α=2
Final answer: 2
Q63Single correctPermutations and Combinations
Let S={1,2,3,…,100}, then number of non-empty subsets A of S such that the product of elements in A is even is :
(A)
(B)
(C)
(D)
SolutionAnswer: Option 3250(250−1)
Approach:
Count subsets whose product is even by subtracting subsets with an odd product (those containing only odd numbers) from all non-empty subsets.
Step 1:The set has 50 even and 50 odd numbers. The product is odd only when every chosen element is odd.
odd-product non-empty subsets=250−1
Step 2:Subtract from all non-empty subsets.
(2100−1)−(250−1)=2100−250
Step 3:Factor the result.
2100−250=250(250−1)
Final answer: 250(250−1)
Q64Single correctPermutations and Combinations
Consider three boxes, each containing 10 balls labelled 1,2,…,10. Suppose one ball is randomly drawn from each of the boxes. Denote by ni, the label of the ball drawn from the ith box, (i=1,2,3). Then, the number of ways in which the balls can be chosen such that n1<n2<n3 is :
(A)
(B)
(C)
(D)
SolutionAnswer: Option 3120
Approach:
Each strictly increasing triple corresponds to choosing 3 distinct labels from 10, which can be arranged in increasing order in exactly one way.
Step 1:For n1<n2<n3, the three labels must be distinct, and any set of three distinct labels has a unique increasing order.
count=(310)
Step 2:Evaluate the combination.
(310)=610⋅9⋅8=120
Final answer: 120
Q65Single correctSequence and Series
Let Sk=k1+2+3+…+k. If S12+S22+…+S102=125A, then A is equal to :
(A)
(B)
(C)
(D)
SolutionAnswer: Option 2303
Approach:
Simplify Sk to (k+1)/2, square it, sum from 1 to 10, then match with 5A/12.
Step 1:Simplify Sk.
Sk=2kk(k+1)=2k+1
Step 2:Sum the squares from k=1 to 10.
∑k=110(2k+1)2=41∑k=211k2=41(506−1)=4505
Step 3:Set equal to 5A/12 and solve.
4505=125A⇒A=4⋅5505⋅12=303
Final answer: 303
Q66Single correctSequence and Series
The product of three consecutive terms of a G.P. is 512. If 4 is added to each of the first and the second of these terms, the three terms now form an A.P., then the sum of the original three terms of the given G.P. is :
(A)
(B)
(C)
(D)
SolutionAnswer: Option 128
Approach:
Write the three terms as a/r, a, ar. Use the product to find a, then apply the A.P. condition after adding 4 to the first two terms to find r.
Step 1:Product of the three terms gives a.
ra⋅a⋅ar=a3=512⇒a=8
Step 2:Apply the A.P. condition to (a/r + 4), (a + 4), ar.
2(a+4)=(ra+4)+ar
Step 3:Solve for r.
24=r8+4+8r⇒8r2−20r+8=0⇒r=2or21
Step 4:Sum the three terms a/r + a + ar.
28+8+8⋅2=4+8+16=28
Final answer: 28
Q67Single correctBinomial Theorem and its Simple Applications
A ratio of the 5th term from the beginning to the 5th term from the end in the binomial expansion of (231+2(3)311)10 is :
(A)
(B)
(C)
(D)
SolutionAnswer: Option 24(36)31:1
Approach:
Compute the 5th term from the beginning (T5) and the 5th term from the end (T7) using the general term, then form their ratio.
Step 1:The 5th term from the beginning is T5 (r=4); the 5th from the end is the 7th term (r=6).
T7T5=(610)a4b6(410)a6b4=b2a2
Step 2:Substitute a=2^(1/3), b=1/(2*3^(1/3)).
b2a2=22/3⋅4⋅32/3=4(4⋅9)1/3=4(36)1/3
Final answer: 4(36)31:1
Q68Single correctTrigonometry
The maximum value of 3cosθ+5sin(θ−6π) for any real value of θ is :
(A)
(B)
(C)
(D)
SolutionAnswer: Option 119
Approach:
Expand the sine term, collect coefficients of cos theta and sin theta, then use the amplitude sqrt(P2+Q2) as the maximum.
Step 1:Expand sin(theta - pi/6).
5sin(θ−6π)=5(23sinθ−21cosθ)
Step 2:Collect coefficients of cos theta and sin theta.
(3−25)cosθ+253sinθ=21cosθ+253sinθ
Step 3:Maximum equals the amplitude.
41+475=476=19
Final answer: 19
Q69Single correctCo-ordinate Geometry
If the straight line 2x−3y+17=0 is perpendicular to the line passing through the points (7,17) and (15,β), then β equals :
(A)
(B)
(C)
(D)
SolutionAnswer: Option 35
Approach:
Find the slope of the given line, then use the perpendicularity condition (product of slopes = -1) with the slope through the two points to solve for beta.
Step 1:Slope of the given line.
2x−3y+17=0⇒m1=32
Step 2:Slope through the two points must be the negative reciprocal.
15−7β−17=−23
Step 3:Solve for beta.
β−17=−12⇒β=5
Final answer: 5
Q70Single correctCo-ordinate Geometry
Let C1 and C2 be the centres of the circles x2+y2−2x−2y−2=0 and x2+y2−6x−6y+14=0 respectively. If P and Q are the points of intersection of these circles, then the area (in sq. units) of the quadrilateral PC1QC2 is :
(A)
(B)
(C)
(D)
SolutionAnswer: Option 24
Approach:
Find the centres, radii and the common chord. The quadrilateral PC1QC2 is a kite split by the line C1C2 into two triangles; compute its area using the diagonals.
Step 1:Identify centres and radii.
C1(1,1),r1=2;C2(3,3),r2=2
Step 2:Find the common chord PQ by subtracting the two circle equations.
4x+4y−16=0⇒x+y=4
Step 3:Diagonal C1C2 length and chord PQ length.
C1C2=22,PQ=2r12−d2=24−2=22
Step 4:Area of the kite with perpendicular diagonals.
21⋅22⋅22=4
Final answer: 4
Q71Single correctCo-ordinate Geometry
If a variable line 3x+4y−λ=0 is such that the two circles x2+y2−2x−2y+1=0 and x2+y2−18x−2y+78=0 are on its opposite sides, then the set of all values of λ is the interval :
(A)
(B)
(C)
(D)
SolutionAnswer: Option 3[12,21]
Approach:
For the two circles to lie on opposite sides of the line, their centres must give the line-expression opposite signs, and the line must not cut either circle (distance from each centre exceeds its radius).
Step 1:Centres and radii.
C1(1,1),r1=1;C2(9,1),r2=2
Step 2:Opposite-side requires the line values at the two centres to have opposite signs.
(3+4−λ)(27+4−λ)<0⇒(7−λ)(31−λ)<0⇒7<λ<31
Step 3:Line must not intersect circle 1: distance from C1 must be at least r1.
5∣7−λ∣≥1⇒λ≤2orλ≥12
Step 4:Line must not intersect circle 2: distance from C2 must be at least r2.
5∣31−λ∣≥2⇒λ≤21orλ≥41
Step 5:Intersect all conditions within (7, 31).
λ∈[12,21]
Final answer: [12,21]
Q72Single correctCo-ordinate Geometry
Let P(4,−4) and Q(9,6) be two points on the parabola, y2=4x and let X be any point on the arc POQ of this parabola, where O is the vertex of this parabola, such that the area of ΔPXQ is maximum. Then this maximum area (in sq. units) is :
(A)
(B)
(C)
(D)
SolutionAnswer: Option 34125
Approach:
Parametrize X on the parabola as (t2, 2t), write the triangle area as a function of t, and maximize it over the relevant arc.
Step 1:Use parametric point X=(t2, 2t) with P(4,-4) and Q(9,6).
Area=214(6−2t)+9(2t+4)+t2(−4−6)
Step 2:Simplify the expression.
Area=21−10t2+10t+60=5−t2+t+6
Step 3:Maximize -t2+t+6 at t=1/2.
−41+21+6=425
Step 4:Multiply by 5.
5⋅425=4125
Final answer: 4125
Q73Single correctCo-ordinate Geometry
If the vertices of a hyperbola be at (−2,0) and (2,0) and one of its foci be at (−3,0), then which one of the following points does not lie on this hyperbola ?
(A)
(B)
(C)
(D)
SolutionAnswer: Option 1(6,52)
Approach:
Determine the hyperbola equation from a and c, then test each point to find the one that does not satisfy it.
Step 1:From vertices a=2 and focus c=3, find b2.
b2=c2−a2=9−4=5
Step 2:Test the points by substitution.
(26,5):424−525=6−5=1✓
Step 3:Test (6, 5*sqrt2).
436−550=9−10=−1=1
Final answer: (6,52)
Q74Single correctLimit, Continuity and Differentiability
x→4πlimcos(x+4π)cot3x−tanx is :
(A)
(B)
(C)
(D)
SolutionAnswer: Option 48
Approach:
Factor the numerator, express cot and tan in terms of cos and sin, and reduce the indeterminate form to a limit that can be evaluated by direct substitution.
Step 2:Express cot x - tan x and the denominator in terms of sine and cosine.
cotx−tanx=21sin2xcos2x,cos(x+4π)=2cosx−sinx
Step 3:Cancel the vanishing factor and substitute x=pi/4.
limx→4πcos(x+4π)cot3x−tanx=8
Final answer: 8
Q75Single correctSets, Relations and Functions
The Boolean expression ((p∧q)∨(p∨∼q))∧(∼p∧∼q) is equivalent to :
(A)
(B)
(C)
(D)
SolutionAnswer: Option 2(∼p)∧(∼q)
Approach:
Simplify the first bracket, then conjoin with (~p AND ~q) using absorption and distributive laws.
Step 1:The first bracket simplifies since p AND q implies p OR (~q).
(p∧q)∨(p∨∼q)=p∨∼q
Step 2:Conjoin with (~p AND ~q).
(p∨∼q)∧(∼p∧∼q)
Step 3:Since ~q is already a factor, the expression reduces.
(∼p∧∼q)
Final answer: (∼p)∧(∼q)
Q76Single correctStatistics and Probability
If the sum of the deviations of 50 observations from 30 is 50, then the mean of these observations is :
(A)
(B)
(C)
(D)
SolutionAnswer: Option 431
Approach:
Relate the sum of deviations from an assumed value to the actual mean.
Step 1:Express the given condition with assumed mean A=30 and n=50.
∑i=150(xi−30)=50
Step 2:Solve for the total of the observations.
∑xi=1550
Step 3:Divide by the number of observations to obtain the mean.
xˉ=501550=31
Final answer: 31
Q77Single correctMatrices and Determinants
Let P=139013001 and Q=[qij] be two 3×3 matrices such that Q−P5=I3. Then q32q21+q31 is equal to :
(A)
(B)
(C)
(D)
SolutionAnswer: Option 110
Approach:
Write P as I plus a strictly lower-triangular nilpotent matrix and expand its powers, then read the required entries of Q.
Step 1:Decompose P into identity plus the nilpotent part N.
N=039003000,N2=009000000,N3=0
Step 2:Compute the fifth power using the expansion truncated at the squared term.
P5=I+5N+10N2
Step 3:Form the entries of P5; since Q=I+P5, the relevant off-diagonal entries of Q equal those of P5.
q21=15,q31=45+90=135,q32=15
Step 4:Evaluate the required ratio.
q32q21+q31=1515+135=10
Final answer: 10
Q78Single correctMatrices and Determinants
An ordered pair (α,β) for which the system of linear equations (1+α)x+βy+z=2 αx+(1+β)y+z=3 αx+βy+2z=2 has a unique solution, is :
(A)
(B)
(C)
(D)
SolutionAnswer: Option 3(2,4)
Approach:
A square system has a unique solution exactly when its coefficient determinant is non-zero; compute that determinant and test the options.
Step 1:Form the coefficient determinant.
Δ=1+αααβ1+ββ112
Step 2:Apply R1->R1-R2 and R3->R3-R2 to simplify.
Δ=1α0−11+β−1011
Step 3:Expand to obtain Delta in terms of alpha and beta.
Δ=2+α+β
Step 4:Unique solution requires Delta nonzero; test each option.
(2,4):2+2+4=8=0
Final answer: (2,4)
Q79Single correctTrigonometry
Considering only the principal values of inverse functions, the set A={x≥0:tan−1(2x)+tan−1(3x)=4π}
(A)
(B)
(C)
(D)
SolutionAnswer: Option 4Is a singleton
Approach:
Combine the two inverse tangents and solve the resulting quadratic, then discard roots that violate the domain restriction.
Step 1:Combine the left side using the addition formula and set equal to pi/4.
1−6x22x+3x=1
Step 2:Rearrange into a quadratic equation.
6x2+5x−1=0
Step 3:Factor and solve.
(6x−1)(x+1)=0⇒x=61orx=−1
Step 4:Apply the constraint x>=0 (and 6x2<1) to keep only valid roots.
x=61
Final answer: Is a singleton
Q80Single correctLimit, Continuity and Differentiability
Let S be the set of all points in (−π,π) at which the function, f(x)=min{sinx,cosx} is not differentiable. Then S is a subset of which of the following?
(A)
(B)
(C)
(D)
SolutionAnswer: Option 2{−43π,−4π,43π,4π}
Approach:
Non-differentiability of the minimum of two smooth functions occurs where the two graphs cross within the interval.
Step 1:Find where sin x equals cos x in the open interval.
tanx=1⇒x=4π+nπ
Step 2:Find where sin x equals -cos x, since the smaller branch can also switch there as the curves meet.
tanx=−1⇒x=−4π,43π
Step 3:Collect the corner points of the min function within (-pi, pi).
S={−43π,−4π,4π,43π}
Step 4:Match this set against the options.
S⊆{−43π,−4π,43π,4π}
Final answer: {−43π,−4π,43π,4π}
Q81Single correctLimit, Continuity and Differentiability
For x>1, if (2x)2y=4e2x−2y, then (1+loge2x)2dxdy is equal to
(A)
(B)
(C)
(D)
SolutionAnswer: Option 2xxloge2x−loge2
Approach:
Take logarithms to linearise the relation, then differentiate implicitly and isolate dy/dx.
Step 1:Take natural logarithm of both sides.
2yln(2x)=ln4+2x−2y
Step 2:Group the y terms and solve for y.
y(ln(2x)+1)=ln2+x⇒y=1+ln(2x)x+ln2
Step 3:Differentiate using the quotient rule with d/dx of ln(2x) equal to 1/x.
dxdy=(1+ln2x)2(1)(1+ln2x)−(x+ln2)⋅x1
Step 4:Multiply by (1+ln2x)2 and simplify the numerator.
Q82Single correctLimit, Continuity and Differentiability
The maximum area (in sq. units) of a rectangle having its base on the x−axis and its other two vertices on the parabola, y=12−x2 such that the rectangle lies inside the parabola, is :
(A)
(B)
(C)
(D)
SolutionAnswer: Option 232
Approach:
Parametrise the rectangle by the abscissa of its upper corner, write the area as a function of that variable, and maximise.
Step 1:Let the upper-right vertex be (x, 12-x2); width is 2x and height is 12-x2.
A(x)=2x(12−x2)=24x−2x3
Step 2:Differentiate and set to zero.
A′(x)=24−6x2=0
Step 3:Confirm a maximum via the second derivative.
A′′(x)=−12x<0 at x=2
Step 4:Evaluate the area at x=2.
A(2)=24(2)−2(8)=48−16=32
Final answer: 32
Q83Single correctIntegral Calculus
The integral ∫cos(lnx)dx, is equal to
(A)
(B)
(C)
(D)
SolutionAnswer: Option 42x(cos(lnx)+sin(lnx))+C
Approach:
Apply integration by parts twice to generate a relation that solves for the integral.
Step 1:Let I be the integral and integrate by parts with u=cos(ln x), dv=dx.
I=xcos(lnx)+∫x⋅xsin(lnx)dx=xcos(lnx)+∫sin(lnx)dx
Step 2:Integrate the new integral by parts with u=sin(ln x), dv=dx.
∫sin(lnx)dx=xsin(lnx)−∫cos(lnx)dx=xsin(lnx)−I
Step 3:Substitute back to form an equation in I.
I=xcos(lnx)+xsin(lnx)−I
Step 4:Solve for I and add the constant.
I=2x(cos(lnx)+sin(lnx))+C
Final answer: 2x(cos(lnx)+sin(lnx))+C
Q84Single correctIntegral Calculus
Let f and g be continuous functions on [0,a] such that f(x)=f(a−x) and g(x)+g(a−x)=4, then ∫0af(x)g(x)dx is equal to
(A)
(B)
(C)
(D)
SolutionAnswer: Option 42∫0af(x)dx
Approach:
Use the king property of definite integrals to combine the integral with its reflection.
Step 1:Denote the integral I and replace x by a-x.
I=∫0af(a−x)g(a−x)dx=∫0af(x)g(a−x)dx
Step 2:Add the two expressions for I.
2I=∫0af(x)(g(x)+g(a−x))dx
Step 3:Use the given condition g(x)+g(a-x)=4.
2I=4∫0af(x)dx
Final answer: 2∫0af(x)dx
Q85Single correctIntegral Calculus
The area (in sq. units) of the region bounded by the parabola, y=x2+2 and the lines, y=x+1,x=0 and x=3, is
(A)
(B)
(C)
(D)
SolutionAnswer: Option 3215
Approach:
Integrate the vertical gap between the parabola and the line over the given x-interval.
Step 1:On [0,3] the parabola lies above the line; form the difference.
(x2+2)−(x+1)=x2−x+1
Step 2:Integrate the difference from 0 to 3.
A=∫03(x2−x+1)dx
Step 3:Evaluate the antiderivative.
A=[3x3−2x2+x]03=9−29+3
Step 4:Simplify.
A=224−9=215
Final answer: 215
Q86Single correctDifferential Equations
Let y=y(x) be the solution of the differential equation, xdxdy+y=xlogex,(x>1). If 2y(2)=loge4−1, then y(e) is equal to
(A)
(B)
(C)
(D)
SolutionAnswer: Option 24e
Approach:
Recognise the left side as the derivative of a product, integrate, and apply the given condition to fix the constant.
Step 1:Rewrite the equation as an exact product derivative.
dxd(xy)=xlogex
Step 2:Integrate both sides; the right side by parts.
xy=2x2lnx−4x2+C
Step 3:Apply 2y(2)=loge 4 -1 to determine C.
2y(2)=2ln2−1+2C=ln4−1⇒C=0
Step 4:Evaluate y at x=e.
y=2xlnx−4x⇒y(e)=2e−4e=4e
Final answer: 4e
Q87Single correctVector Algebra
The sum of the distinct real values of μ for which the vectors μi^+j^+k^,i^+μj^+k^,i^+j^+μk^ are co-planar, is
(A)
(B)
(C)
(D)
SolutionAnswer: Option 2−1
Approach:
Coplanarity of three vectors requires their scalar triple product, i.e. the determinant of components, to vanish.
Step 1:Set the determinant of the coefficient matrix to zero.
μ111μ111μ=0
Step 2:Expand using the standard identity for this symmetric determinant.
μ3−3μ+2=0
Step 3:Factor the cubic.
(μ−1)2(μ+2)=0⇒μ=1,−2
Step 4:Add the distinct real values.
1+(−2)=−1
Final answer: −1
Q88Single correctThree Dimensional Geometry
A tetrahedron has vertices P(1,2,1),Q(2,1,3),R(−1,1,2) and O(0,0,0). The angle between the faces OPQ and PQR is
(A)
(B)
(C)
(D)
SolutionAnswer: Option 3cos−1(3519)
Approach:
Find the normals of the two faces along edge PQ via cross products, then the angle between them.
Step 1:Normal of face OPQ from OP and OQ.
n1=OP×OQ=(5,−1,−3)
Step 2:Normal of face PQR from PQ and PR.
n2=PQ×PR=(1,−5,−3)
Step 3:Angle between the faces.
cosθ=35355+5+9=3519
Final answer: cos−1(3519)
Q89Single correctThree Dimensional Geometry
The perpendicular distance from the origin to the plane containing the two lines, 3x+2=5y−2=7z+5 and 1x−1=4y−4=7z+4, is
(A)
(B)
(C)
(D)
SolutionAnswer: Option 2611
Approach:
Find the plane normal from the cross product of the two direction vectors, fix the plane through a known point, then apply the point-to-plane distance.
Step 1:Cross the two direction vectors to get the plane normal.
(3,5,7)×(1,4,7)=(7,−14,7)∥(1,−2,1)
Step 2:Write the plane through (-2,2,-5).
1(x+2)−2(y−2)+1(z+5)=0⇒x−2y+z+11=0
Step 3:Apply the distance formula from the origin.
d=1+4+1∣0−0+0+11∣=611
Final answer: 611
Q90Single correctStatistics and Probability
In a random experiment, a fair die is rolled until two fours are obtained in succession. The probability that the experiment will end in the fifth throw of the die is equal to :
(A)
(B)
(C)
(D)
SolutionAnswer: Option 265175
Approach:
The experiment ends on the fifth throw exactly when throws four and five are fours and no two consecutive fours occur among the first four throws.
Step 1:Throws 4 and 5 must be fours; throw 3 must not be a four to avoid an earlier ending.
P4=P5=61,P3=65
Step 2:Throws 1 and 2 must not contain two consecutive fours; count the allowed pairs out of 36.
36−1=35ordered pairs without 4,4
Step 3:Count first-two-throw outcomes with no double-four ending: total pairs minus the single (4,4) pair gives 35; combine with the fixed later throws.
How many questions are in the JEE Main 2019 January 12, Shift 1 paper?
The JEE Main 2019 January 12, Shift 1 paper has 90 questions — Physics (30), Chemistry (30) and Mathematics (30). Every question is on this page with its correct answer and a step-by-step solution.
What is the marking scheme for JEE Main?
JEE Main awards +4 marks for each correct answer and −1 for a wrong answer, with 0 for questions left unattempted. The paper covers Physics, Chemistry and Mathematics.
Are the answer key and step-by-step solutions provided for the 2019 January 12, Shift 1 paper?
Yes — every question shows the correct answer (answer key) and a detailed step-by-step solution, free to read online.
Can I take the JEE Main 2019 January 12, Shift 1 paper as a timed mock test?
Yes. With a free JEEnify account you can attempt this exact paper as a timed test in the real exam interface, then see your score and weak-area analysis.